C14H22N2O5S — CID 120717524
methyl 3-[2-(2-methoxyethylamino)ethylsulfamoyl]-4-methylbenzoate (PubChem CID 120717524) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is methyl 3-[2-(2-methoxyethylamino)ethylsulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[2-(2-methoxyethylamino)ethylsulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 120717524 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 3-[2-(2-methoxyethylamino)ethylsulfamoyl]-4-methylbenzoate |
| SMILES | COCCNCCNS(=O)(=O)c1cc(C(=O)OC)ccc1C |
| InChI | InChI=1S/C14H22N2O5S/c1-11-4-5-12(14(17)21-3)10-13(11)22(18,19)16-7-6-15-8-9-20-2/h4-5,10,15-16H,6-9H2,1-3H3 |
| InChIKey | ZADGPRCIMHKIRN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|