C13H19NO5S — CID 39999060
methyl 3-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]-4-methylbenzoate (PubChem CID 39999060) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl 3-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 39999060 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | methyl 3-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]-4-methylbenzoate |
| SMILES | COC[C@H](C)NS(=O)(=O)c1cc(C(=O)OC)ccc1C |
| InChI | InChI=1S/C13H19NO5S/c1-9-5-6-11(13(15)19-4)7-12(9)20(16,17)14-10(2)8-18-3/h5-7,10,14H,8H2,1-4H3/t10-/m0/s1 |
| InChIKey | ZQCQOVYXIURIFK-JTQLQIEISA-N |
| XLogP | 1.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |