C13H20N2O6S — CID 99981147
4-(2-hydroxyethylamino)-3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid (PubChem CID 99981147) has the molecular formula C13H20N2O6S and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-(2-hydroxyethylamino)-3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 4-(2-hydroxyethylamino)-3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99981147 |
| Molecular Formula | C13H20N2O6S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-(2-hydroxyethylamino)-3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoic acid |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1cc(C(=O)O)ccc1NCCO |
| InChI | InChI=1S/C13H20N2O6S/c1-9(8-21-2)15-22(19,20)12-7-10(13(17)18)3-4-11(12)14-5-6-16/h3-4,7,9,14-16H,5-6,8H2,1-2H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | IGOHIHHEVYTHSV-SECBINFHSA-N |
| XLogP | 0.10 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |