C14H22N2O6S — CID 132652725
3-(3-hydroxypropylsulfamoyl)-4-(1-methoxypropan-2-ylamino)benzoic acid (PubChem CID 132652725) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-(3-hydroxypropylsulfamoyl)-4-(1-methoxypropan-2-ylamino)benzoic acid.
| Compound Name | 3-(3-hydroxypropylsulfamoyl)-4-(1-methoxypropan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 132652725 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-(3-hydroxypropylsulfamoyl)-4-(1-methoxypropan-2-ylamino)benzoic acid |
| SMILES | COCC(C)Nc1ccc(C(=O)O)cc1S(=O)(=O)NCCCO |
| InChI | InChI=1S/C14H22N2O6S/c1-10(9-22-2)16-12-5-4-11(14(18)19)8-13(12)23(20,21)15-6-3-7-17/h4-5,8,10,15-17H,3,6-7,9H2,1-2H3,(H,18,19) |
| InChIKey | QIGPBSJYBFXYBC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|