C17H28N2O6S — CID 99980434
4-[[(2S)-1-methoxypropan-2-yl]amino]-3-(3-propan-2-yloxypropylsulfamoyl)benzoic acid (PubChem CID 99980434) has the molecular formula C17H28N2O6S and a molecular weight of 388.49 g/mol. Its IUPAC name is 4-[[(2S)-1-methoxypropan-2-yl]amino]-3-(3-propan-2-yloxypropylsulfamoyl)benzoic acid.
| Compound Name | 4-[[(2S)-1-methoxypropan-2-yl]amino]-3-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99980434 |
| Molecular Formula | C17H28N2O6S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-[[(2S)-1-methoxypropan-2-yl]amino]-3-(3-propan-2-yloxypropylsulfamoyl)benzoic acid |
| SMILES | COC[C@H](C)Nc1ccc(C(=O)O)cc1S(=O)(=O)NCCCOC(C)C |
| InChI | InChI=1S/C17H28N2O6S/c1-12(2)25-9-5-8-18-26(22,23)16-10-14(17(20)21)6-7-15(16)19-13(3)11-24-4/h6-7,10,12-13,18-19H,5,8-9,11H2,1-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | HKDZGOIZJJVGQL-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|