C11H16N2O5S — CID 132649855
4-(1-methoxypropan-2-ylamino)-3-sulfamoylbenzoic acid (PubChem CID 132649855) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-(1-methoxypropan-2-ylamino)-3-sulfamoylbenzoic acid.
| Compound Name | 4-(1-methoxypropan-2-ylamino)-3-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 132649855 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-(1-methoxypropan-2-ylamino)-3-sulfamoylbenzoic acid |
| SMILES | COCC(C)Nc1ccc(C(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O5S/c1-7(6-18-2)13-9-4-3-8(11(14)15)5-10(9)19(12,16)17/h3-5,7,13H,6H2,1-2H3,(H,14,15)(H2,12,16,17) |
| InChIKey | IHJKJNWOVWWUFP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |