C14H20N2O5S — CID 99981112
3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]-4-(prop-2-enylamino)benzoic acid (PubChem CID 99981112) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]-4-(prop-2-enylamino)benzoic acid.
| Compound Name | 3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]-4-(prop-2-enylamino)benzoic acid |
|---|---|
| PubChem CID | 99981112 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]-4-(prop-2-enylamino)benzoic acid |
| SMILES | C=CCNc1ccc(C(=O)O)cc1S(=O)(=O)N[C@H](C)COC |
| InChI | InChI=1S/C14H20N2O5S/c1-4-7-15-12-6-5-11(14(17)18)8-13(12)22(19,20)16-10(2)9-21-3/h4-6,8,10,15-16H,1,7,9H2,2-3H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | GMVHAOJINODKAG-SNVBAGLBSA-N |
| XLogP | 1.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|