C16H24N2O4S — CID 120584848
methyl 3-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methylbenzoate (PubChem CID 120584848) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is methyl 3-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 120584848 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl 3-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)NC(CN)C2CCCC2)c1 |
| InChI | InChI=1S/C16H24N2O4S/c1-11-7-8-13(16(19)22-2)9-15(11)23(20,21)18-14(10-17)12-5-3-4-6-12/h7-9,12,14,18H,3-6,10,17H2,1-2H3 |
| InChIKey | ZICOUOREEZCZIA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |