C14H22N2O5S2 — CID 120585239
methyl 5-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methoxythiophene-2-carboxylate (PubChem CID 120585239) has the molecular formula C14H22N2O5S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl 5-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methoxythiophene-2-carboxylate.
| Compound Name | methyl 5-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methoxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 120585239 |
| Molecular Formula | C14H22N2O5S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl 5-[(2-amino-1-cyclopentylethyl)sulfamoyl]-4-methoxythiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c(S(=O)(=O)NC(CN)C2CCCC2)s1 |
| InChI | InChI=1S/C14H22N2O5S2/c1-20-11-7-12(13(17)21-2)22-14(11)23(18,19)16-10(8-15)9-5-3-4-6-9/h7,9-10,16H,3-6,8,15H2,1-2H3 |
| InChIKey | HUUAOJGWKGKXDZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |