C13H20N2O5S2 — CID 119980905
methyl 5-[[1-(aminomethyl)cyclopentyl]sulfamoyl]-4-methoxythiophene-2-carboxylate (PubChem CID 119980905) has the molecular formula C13H20N2O5S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is methyl 5-[[1-(aminomethyl)cyclopentyl]sulfamoyl]-4-methoxythiophene-2-carboxylate.
| Compound Name | methyl 5-[[1-(aminomethyl)cyclopentyl]sulfamoyl]-4-methoxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 119980905 |
| Molecular Formula | C13H20N2O5S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | methyl 5-[[1-(aminomethyl)cyclopentyl]sulfamoyl]-4-methoxythiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c(S(=O)(=O)NC2(CN)CCCC2)s1 |
| InChI | InChI=1S/C13H20N2O5S2/c1-19-9-7-10(11(16)20-2)21-12(9)22(17,18)15-13(8-14)5-3-4-6-13/h7,15H,3-6,8,14H2,1-2H3 |
| InChIKey | LOUFDLFZPHTVAZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |