C13H22N2O5S2 — CID 119981396
methyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-4-methoxythiophene-2-carboxylate (PubChem CID 119981396) has the molecular formula C13H22N2O5S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-4-methoxythiophene-2-carboxylate.
| Compound Name | methyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-4-methoxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 119981396 |
| Molecular Formula | C13H22N2O5S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | methyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-4-methoxythiophene-2-carboxylate |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1sc(C(=O)OC)cc1OC |
| InChI | InChI=1S/C13H22N2O5S2/c1-5-13(6-2,8-14)15-22(17,18)12-9(19-3)7-10(21-12)11(16)20-4/h7,15H,5-6,8,14H2,1-4H3 |
| InChIKey | JAPJAEVFKTURFJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |