C14H22Cl2N2O4S — CID 119981323
methyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]-5-chlorobenzoate;hydrochloride (PubChem CID 119981323) has the molecular formula C14H22Cl2N2O4S and a molecular weight of 385.31 g/mol. Its IUPAC name is methyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]-5-chlorobenzoate;hydrochloride.
| Compound Name | methyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]-5-chlorobenzoate;hydrochloride |
|---|---|
| PubChem CID | 119981323 |
| Molecular Formula | C14H22Cl2N2O4S |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | methyl 3-[3-(aminomethyl)pentan-3-ylsulfamoyl]-5-chlorobenzoate;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1cc(Cl)cc(C(=O)OC)c1.Cl |
| InChI | InChI=1S/C14H21ClN2O4S.ClH/c1-4-14(5-2,9-16)17-22(19,20)12-7-10(13(18)21-3)6-11(15)8-12;/h6-8,17H,4-5,9,16H2,1-3H3;1H |
| InChIKey | BBZZQRAIJNLCCS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |