C15H27ClN2O4S — CID 119981229
N-[3-(aminomethyl)pentan-3-yl]-4-(2-methoxyethoxy)benzenesulfonamide;hydrochloride (PubChem CID 119981229) has the molecular formula C15H27ClN2O4S and a molecular weight of 366.91 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-(2-methoxyethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-(2-methoxyethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119981229 |
| Molecular Formula | C15H27ClN2O4S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-(2-methoxyethoxy)benzenesulfonamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1ccc(OCCOC)cc1.Cl |
| InChI | InChI=1S/C15H26N2O4S.ClH/c1-4-15(5-2,12-16)17-22(18,19)14-8-6-13(7-9-14)21-11-10-20-3;/h6-9,17H,4-5,10-12,16H2,1-3H3;1H |
| InChIKey | BCRCCXOWHFNQEN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|