C14H23NO5S — CID 65113406
N-(2-hydroxy-2-methylbutyl)-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 65113406) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylbutyl)-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-methylbutyl)-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 65113406 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(2-hydroxy-2-methylbutyl)-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | CCC(C)(O)CNS(=O)(=O)c1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C14H23NO5S/c1-4-14(2,16)11-15-21(17,18)13-7-5-12(6-8-13)20-10-9-19-3/h5-8,15-16H,4,9-11H2,1-3H3 |
| InChIKey | OPHPXORZCBYJCI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|