C14H23NO4S2 — CID 90523134
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-propoxybenzenesulfonamide (PubChem CID 90523134) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-propoxybenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90523134 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NCC(C)(O)CSC)cc1 |
| InChI | InChI=1S/C14H23NO4S2/c1-4-9-19-12-5-7-13(8-6-12)21(17,18)15-10-14(2,16)11-20-3/h5-8,15-16H,4,9-11H2,1-3H3 |
| InChIKey | GVQQUMWLCYYPTN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |