C10H16N2O3S2 — CID 90523077
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide (PubChem CID 90523077) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 90523077 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)pyridine-3-sulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-10(13,8-16-2)7-12-17(14,15)9-4-3-5-11-6-9/h3-6,12-13H,7-8H2,1-2H3 |
| InChIKey | OSDYLXDHJVPENP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |