C8H15N3O3S2 — CID 106245543
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106245543) has the molecular formula C8H15N3O3S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106245543 |
| Molecular Formula | C8H15N3O3S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CSCC(C)(O)CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H15N3O3S2/c1-8(12,6-15-2)5-10-16(13,14)7-3-4-9-11-7/h3-4,10,12H,5-6H2,1-2H3,(H,9,11) |
| InChIKey | HZBSECCWCPUWSR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |