C6H11N3O3S — CID 102693499
N-[(2R)-2-hydroxypropyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102693499) has the molecular formula C6H11N3O3S and a molecular weight of 205.24 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693499 |
| Molecular Formula | C6H11N3O3S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-1H-pyrazole-5-sulfonamide |
| SMILES | C[C@@H](O)CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C6H11N3O3S/c1-5(10)4-8-13(11,12)6-2-3-7-9-6/h2-3,5,8,10H,4H2,1H3,(H,7,9)/t5-/m1/s1 |
| InChIKey | YONYLGQJDPWKHW-RXMQYKEDSA-N |
| XLogP | -0.93 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |