C8H15N3O3S — CID 102693400
N-(2-hydroxypentyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693400) has the molecular formula C8H15N3O3S and a molecular weight of 233.29 g/mol. Its IUPAC name is N-(2-hydroxypentyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-hydroxypentyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693400 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(2-hydroxypentyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCCC(O)CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H15N3O3S/c1-2-3-7(12)6-10-15(13,14)8-4-5-9-11-8/h4-5,7,10,12H,2-3,6H2,1H3,(H,9,11) |
| InChIKey | WXCUEWPATUWSDY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |