C7H13N3O3S — CID 102691892
N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102691892) has the molecular formula C7H13N3O3S and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691892 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-(2-ethoxyethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C7H13N3O3S/c1-2-13-6-5-9-14(11,12)7-3-4-8-10-7/h3-4,9H,2,5-6H2,1H3,(H,8,10) |
| InChIKey | UZIOXBUDISUSOO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|