C8H15N3O4S — CID 102692888
N-[2-(2-methoxyethoxy)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102692888) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692888 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | COCCOCCNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H15N3O4S/c1-14-6-7-15-5-4-10-16(12,13)8-2-3-9-11-8/h2-3,10H,4-7H2,1H3,(H,9,11) |
| InChIKey | ZMQBBQPLBLKWSD-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|