C9H17N3O3S — CID 102692369
N-(2-butoxyethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692369) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-(2-butoxyethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-butoxyethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692369 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(2-butoxyethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCCCOCCNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H17N3O3S/c1-2-3-7-15-8-6-11-16(13,14)9-4-5-10-12-9/h4-5,11H,2-3,6-8H2,1H3,(H,10,12) |
| InChIKey | CHRZJBQTNHRFPT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|