C8H14ClN3O3S — CID 106245564
N-(3-chloro-4-methoxybutyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106245564) has the molecular formula C8H14ClN3O3S and a molecular weight of 267.74 g/mol. Its IUPAC name is N-(3-chloro-4-methoxybutyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3-chloro-4-methoxybutyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106245564 |
| Molecular Formula | C8H14ClN3O3S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-(3-chloro-4-methoxybutyl)-1H-pyrazole-5-sulfonamide |
| SMILES | COCC(Cl)CCNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H14ClN3O3S/c1-15-6-7(9)2-5-11-16(13,14)8-3-4-10-12-8/h3-4,7,11H,2,5-6H2,1H3,(H,10,12) |
| InChIKey | HSCYULOKLUOGFW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|