C11H14Cl3NO3S — CID 114163434
2,5-dichloro-N-(3-chloro-4-methoxybutyl)benzenesulfonamide (PubChem CID 114163434) has the molecular formula C11H14Cl3NO3S and a molecular weight of 346.66 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-chloro-4-methoxybutyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(3-chloro-4-methoxybutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114163434 |
| Molecular Formula | C11H14Cl3NO3S |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2,5-dichloro-N-(3-chloro-4-methoxybutyl)benzenesulfonamide |
| SMILES | COCC(Cl)CCNS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl3NO3S/c1-18-7-9(13)4-5-15-19(16,17)11-6-8(12)2-3-10(11)14/h2-3,6,9,15H,4-5,7H2,1H3 |
| InChIKey | DZWBOACVLQQTMO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|