C12H16Cl3NO2S — CID 107849099
2,5-dichloro-N-(6-chlorohexyl)benzenesulfonamide (PubChem CID 107849099) has the molecular formula C12H16Cl3NO2S and a molecular weight of 344.69 g/mol. Its IUPAC name is 2,5-dichloro-N-(6-chlorohexyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(6-chlorohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107849099 |
| Molecular Formula | C12H16Cl3NO2S |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2,5-dichloro-N-(6-chlorohexyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCCCCl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H16Cl3NO2S/c13-7-3-1-2-4-8-16-19(17,18)12-9-10(14)5-6-11(12)15/h5-6,9,16H,1-4,7-8H2 |
| InChIKey | NNBJNLZAXWFGHA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|