C9H10BrCl2NO2S — CID 43167077
N-(3-bromopropyl)-2,5-dichlorobenzenesulfonamide (PubChem CID 43167077) has the molecular formula C9H10BrCl2NO2S and a molecular weight of 347.06 g/mol. Its IUPAC name is N-(3-bromopropyl)-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(3-bromopropyl)-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 43167077 |
| Molecular Formula | C9H10BrCl2NO2S |
| Molecular Weight | 347.06 g/mol |
| Exact Mass | 344.90 |
| IUPAC Name | N-(3-bromopropyl)-2,5-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCBr)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H10BrCl2NO2S/c10-4-1-5-13-16(14,15)9-6-7(11)2-3-8(9)12/h2-3,6,13H,1,4-5H2 |
| InChIKey | JNMLAKOZHGJUST-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.06 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|