C16H18Cl2N2O4S2 — CID 2190292
N-[4-(butylsulfamoyl)phenyl]-2,5-dichlorobenzenesulfonamide (PubChem CID 2190292) has the molecular formula C16H18Cl2N2O4S2 and a molecular weight of 437.37 g/mol. Its IUPAC name is N-[4-(butylsulfamoyl)phenyl]-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-[4-(butylsulfamoyl)phenyl]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 2190292 |
| Molecular Formula | C16H18Cl2N2O4S2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | N-[4-(butylsulfamoyl)phenyl]-2,5-dichlorobenzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H18Cl2N2O4S2/c1-2-3-10-19-25(21,22)14-7-5-13(6-8-14)20-26(23,24)16-11-12(17)4-9-15(16)18/h4-9,11,19-20H,2-3,10H2,1H3 |
| InChIKey | NVZFEQORGMNQOD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|