C10H12Cl2N2O2S2 — CID 62668104
4-[(2,5-dichlorophenyl)sulfonylamino]butanethioamide (PubChem CID 62668104) has the molecular formula C10H12Cl2N2O2S2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenyl)sulfonylamino]butanethioamide.
| Compound Name | 4-[(2,5-dichlorophenyl)sulfonylamino]butanethioamide |
|---|---|
| PubChem CID | 62668104 |
| Molecular Formula | C10H12Cl2N2O2S2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-[(2,5-dichlorophenyl)sulfonylamino]butanethioamide |
| SMILES | NC(=S)CCCNS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2S2/c11-7-3-4-8(12)9(6-7)18(15,16)14-5-1-2-10(13)17/h3-4,6,14H,1-2,5H2,(H2,13,17) |
| InChIKey | YUXHSFQJJGUFPN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|