C10H12Cl2N2O2S2 — CID 43344046
3-[(2,5-dichlorophenyl)sulfonyl-methylamino]propanethioamide (PubChem CID 43344046) has the molecular formula C10H12Cl2N2O2S2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]propanethioamide.
| Compound Name | 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]propanethioamide |
|---|---|
| PubChem CID | 43344046 |
| Molecular Formula | C10H12Cl2N2O2S2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)sulfonyl-methylamino]propanethioamide |
| SMILES | CN(CCC(N)=S)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2S2/c1-14(5-4-10(13)17)18(15,16)9-6-7(11)2-3-8(9)12/h2-3,6H,4-5H2,1H3,(H2,13,17) |
| InChIKey | JZWZEADPFYVLDI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|