C11H14BrCl2NO3S — CID 114242902
N-[2-(2-bromoethoxy)ethyl]-2,5-dichloro-N-methylbenzenesulfonamide (PubChem CID 114242902) has the molecular formula C11H14BrCl2NO3S and a molecular weight of 391.11 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-2,5-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-2,5-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114242902 |
| Molecular Formula | C11H14BrCl2NO3S |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-2,5-dichloro-N-methylbenzenesulfonamide |
| SMILES | CN(CCOCCBr)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14BrCl2NO3S/c1-15(5-7-18-6-4-12)19(16,17)11-8-9(13)2-3-10(11)14/h2-3,8H,4-7H2,1H3 |
| InChIKey | DFYLIOOPZFQZBC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|