C10H12Br2ClNO2S — CID 106441744
4-bromo-N-(3-bromopropyl)-2-chloro-N-methylbenzenesulfonamide (PubChem CID 106441744) has the molecular formula C10H12Br2ClNO2S and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-bromo-N-(3-bromopropyl)-2-chloro-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-(3-bromopropyl)-2-chloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106441744 |
| Molecular Formula | C10H12Br2ClNO2S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | 4-bromo-N-(3-bromopropyl)-2-chloro-N-methylbenzenesulfonamide |
| SMILES | CN(CCCBr)S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H12Br2ClNO2S/c1-14(6-2-5-11)17(15,16)10-4-3-8(12)7-9(10)13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | NJARDXUFHHMGGD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|