C10H13Br2NO3S — CID 47305772
2,4-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide (PubChem CID 47305772) has the molecular formula C10H13Br2NO3S and a molecular weight of 387.09 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 47305772 |
| Molecular Formula | C10H13Br2NO3S |
| Molecular Weight | 387.09 g/mol |
| Exact Mass | 384.90 |
| IUPAC Name | 2,4-dibromo-N-(2-methoxyethyl)-N-methylbenzenesulfonamide |
| SMILES | COCCN(C)S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H13Br2NO3S/c1-13(5-6-16-2)17(14,15)10-4-3-8(11)7-9(10)12/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | VRHZBAPIXJJNPI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.09 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |