C12H18BrNO3S — CID 81062273
2-bromo-N-(2-ethoxyethyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 81062273) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 2-bromo-N-(2-ethoxyethyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | 2-bromo-N-(2-ethoxyethyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 81062273 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-bromo-N-(2-ethoxyethyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | CCOCCN(C)S(=O)(=O)c1ccc(C)cc1Br |
| InChI | InChI=1S/C12H18BrNO3S/c1-4-17-8-7-14(3)18(15,16)12-6-5-10(2)9-11(12)13/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | XYIJWCOPXSJRDO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|