C15H15Br2NO2S — CID 46567304
2-bromo-N-[(4-bromophenyl)methyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 46567304) has the molecular formula C15H15Br2NO2S and a molecular weight of 433.17 g/mol. Its IUPAC name is 2-bromo-N-[(4-bromophenyl)methyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | 2-bromo-N-[(4-bromophenyl)methyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 46567304 |
| Molecular Formula | C15H15Br2NO2S |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | 2-bromo-N-[(4-bromophenyl)methyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)Cc2ccc(Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C15H15Br2NO2S/c1-11-3-8-15(14(17)9-11)21(19,20)18(2)10-12-4-6-13(16)7-5-12/h3-9H,10H2,1-2H3 |
| InChIKey | IFGOMEGXQXWRMY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |