C11H15Br2NO3S — CID 81062460
2,4-dibromo-N-(2-ethoxyethyl)-N-methylbenzenesulfonamide (PubChem CID 81062460) has the molecular formula C11H15Br2NO3S and a molecular weight of 401.12 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-ethoxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2-ethoxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81062460 |
| Molecular Formula | C11H15Br2NO3S |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 2,4-dibromo-N-(2-ethoxyethyl)-N-methylbenzenesulfonamide |
| SMILES | CCOCCN(C)S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2NO3S/c1-3-17-7-6-14(2)18(15,16)11-5-4-9(12)8-10(11)13/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | PCIZYUYMDKETJJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|