C9H12BrNO3S — CID 60765176
2-bromo-N-methoxy-N,4-dimethylbenzenesulfonamide (PubChem CID 60765176) has the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. Its IUPAC name is 2-bromo-N-methoxy-N,4-dimethylbenzenesulfonamide.
| Compound Name | 2-bromo-N-methoxy-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 60765176 |
| Molecular Formula | C9H12BrNO3S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2-bromo-N-methoxy-N,4-dimethylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1ccc(C)cc1Br |
| InChI | InChI=1S/C9H12BrNO3S/c1-7-4-5-9(8(10)6-7)15(12,13)11(2)14-3/h4-6H,1-3H3 |
| InChIKey | HXFMHBPUEPSSSU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|