C11H16BrNO4S — CID 61217446
2-bromo-N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide (PubChem CID 61217446) has the molecular formula C11H16BrNO4S and a molecular weight of 338.22 g/mol. Its IUPAC name is 2-bromo-N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | 2-bromo-N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61217446 |
| Molecular Formula | C11H16BrNO4S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2-bromo-N,N-bis(2-hydroxyethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCO)CCO)c(Br)c1 |
| InChI | InChI=1S/C11H16BrNO4S/c1-9-2-3-11(10(12)8-9)18(16,17)13(4-6-14)5-7-15/h2-3,8,14-15H,4-7H2,1H3 |
| InChIKey | KOYPZOJEQWRVAK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |