C10H14BrNO3S — CID 60957937
2-bromo-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 60957937) has the molecular formula C10H14BrNO3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-bromo-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60957937 |
| Molecular Formula | C10H14BrNO3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-bromo-N-ethyl-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCN(CCO)S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C10H14BrNO3S/c1-2-12(7-8-13)16(14,15)10-6-4-3-5-9(10)11/h3-6,13H,2,7-8H2,1H3 |
| InChIKey | PUWOESMDSJSHNP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |