C11H16BrN3O3S — CID 54992954
3-[(2-bromophenyl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide (PubChem CID 54992954) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is 3-[(2-bromophenyl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(2-bromophenyl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 54992954 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3-[(2-bromophenyl)sulfonyl-ethylamino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CC/C(N)=N/O)S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C11H16BrN3O3S/c1-2-15(8-7-11(13)14-16)19(17,18)10-6-4-3-5-9(10)12/h3-6,16H,2,7-8H2,1H3,(H2,13,14) |
| InChIKey | QCCNERBQXOPBAY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|