C10H17N3O3S2 — CID 54992517
3-[ethyl-(5-methylthiophen-2-yl)sulfonylamino]-N'-hydroxypropanimidamide (PubChem CID 54992517) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-[ethyl-(5-methylthiophen-2-yl)sulfonylamino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[ethyl-(5-methylthiophen-2-yl)sulfonylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 54992517 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-[ethyl-(5-methylthiophen-2-yl)sulfonylamino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CC/C(N)=N/O)S(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C10H17N3O3S2/c1-3-13(7-6-9(11)12-14)18(15,16)10-5-4-8(2)17-10/h4-5,14H,3,6-7H2,1-2H3,(H2,11,12) |
| InChIKey | NLCYVJXSUPTFHL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|