C9H14ClNO2S2 — CID 63397238
N-(2-chloroethyl)-N-ethyl-5-methylthiophene-2-sulfonamide (PubChem CID 63397238) has the molecular formula C9H14ClNO2S2 and a molecular weight of 267.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-ethyl-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(2-chloroethyl)-N-ethyl-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 63397238 |
| Molecular Formula | C9H14ClNO2S2 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | N-(2-chloroethyl)-N-ethyl-5-methylthiophene-2-sulfonamide |
| SMILES | CCN(CCCl)S(=O)(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C9H14ClNO2S2/c1-3-11(7-6-10)15(12,13)9-5-4-8(2)14-9/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | QAAJCCJJLNSARJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|