C10H12Cl3NO2S — CID 63397566
3,4-dichloro-N-(2-chloroethyl)-N-ethylbenzenesulfonamide (PubChem CID 63397566) has the molecular formula C10H12Cl3NO2S and a molecular weight of 316.64 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-chloroethyl)-N-ethylbenzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(2-chloroethyl)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 63397566 |
| Molecular Formula | C10H12Cl3NO2S |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 3,4-dichloro-N-(2-chloroethyl)-N-ethylbenzenesulfonamide |
| SMILES | CCN(CCCl)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl3NO2S/c1-2-14(6-5-11)17(15,16)8-3-4-9(12)10(13)7-8/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | ADMIYEJEASMWAI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|