C10H10Cl3F2NO2S — CID 107492813
3,4-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)benzenesulfonamide (PubChem CID 107492813) has the molecular formula C10H10Cl3F2NO2S and a molecular weight of 352.62 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107492813 |
| Molecular Formula | C10H10Cl3F2NO2S |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 3,4-dichloro-N-(2-chloroethyl)-N-(2,2-difluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N(CCCl)CC(F)F |
| InChI | InChI=1S/C10H10Cl3F2NO2S/c11-3-4-16(6-10(14)15)19(17,18)7-1-2-8(12)9(13)5-7/h1-2,5,10H,3-4,6H2 |
| InChIKey | OFVLZBDMXYOASB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|