C11H12Cl3F2N — CID 107488031
N-(2-chloroethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2-difluoroethanamine (PubChem CID 107488031) has the molecular formula C11H12Cl3F2N and a molecular weight of 302.58 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-chloroethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107488031 |
| Molecular Formula | C11H12Cl3F2N |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | N-(2-chloroethyl)-N-[(2,5-dichlorophenyl)methyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CN(CCCl)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl3F2N/c12-3-4-17(7-11(15)16)6-8-5-9(13)1-2-10(8)14/h1-2,5,11H,3-4,6-7H2 |
| InChIKey | YYAQEFNFJFGTCH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|