C16H16Cl3N — CID 63389500
N-benzyl-2-chloro-N-[(2,4-dichlorophenyl)methyl]ethanamine (PubChem CID 63389500) has the molecular formula C16H16Cl3N and a molecular weight of 328.67 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[(2,4-dichlorophenyl)methyl]ethanamine.
| Compound Name | N-benzyl-2-chloro-N-[(2,4-dichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63389500 |
| Molecular Formula | C16H16Cl3N |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-benzyl-2-chloro-N-[(2,4-dichlorophenyl)methyl]ethanamine |
| SMILES | ClCCN(Cc1ccccc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl3N/c17-8-9-20(11-13-4-2-1-3-5-13)12-14-6-7-15(18)10-16(14)19/h1-7,10H,8-9,11-12H2 |
| InChIKey | VYAQDEKNEQKINY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|