C13H19Cl2N — CID 117059460
N-[(2,4-dichlorophenyl)methyl]-N-propylpropan-1-amine (PubChem CID 117059460) has the molecular formula C13H19Cl2N and a molecular weight of 260.21 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-propylpropan-1-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 117059460 |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2N/c1-3-7-16(8-4-2)10-11-5-6-12(14)9-13(11)15/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | JJCATLFTPIXDBM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |