C11H14Cl3N — CID 115215774
3-chloro-N-[(2,4-dichlorophenyl)methyl]-N-methylpropan-1-amine (PubChem CID 115215774) has the molecular formula C11H14Cl3N and a molecular weight of 266.60 g/mol. Its IUPAC name is 3-chloro-N-[(2,4-dichlorophenyl)methyl]-N-methylpropan-1-amine.
| Compound Name | 3-chloro-N-[(2,4-dichlorophenyl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 115215774 |
| Molecular Formula | C11H14Cl3N |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 3-chloro-N-[(2,4-dichlorophenyl)methyl]-N-methylpropan-1-amine |
| SMILES | CN(CCCCl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3N/c1-15(6-2-5-12)8-9-3-4-10(13)7-11(9)14/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | CBENFNUBVRKYKK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|