C12H18Cl2N2 — CID 115201351
N'-[(2,4-dichlorophenyl)methyl]-N'-methylbutane-1,4-diamine (PubChem CID 115201351) has the molecular formula C12H18Cl2N2 and a molecular weight of 261.20 g/mol. Its IUPAC name is N'-[(2,4-dichlorophenyl)methyl]-N'-methylbutane-1,4-diamine.
| Compound Name | N'-[(2,4-dichlorophenyl)methyl]-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115201351 |
| Molecular Formula | C12H18Cl2N2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N'-[(2,4-dichlorophenyl)methyl]-N'-methylbutane-1,4-diamine |
| SMILES | CN(CCCCN)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2/c1-16(7-3-2-6-15)9-10-4-5-11(13)8-12(10)14/h4-5,8H,2-3,6-7,9,15H2,1H3 |
| InChIKey | MLYSGJACUBENBV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|