C9H10Cl3N — CID 115263252
N-(chloromethyl)-1-(2,4-dichlorophenyl)-N-methylmethanamine (PubChem CID 115263252) has the molecular formula C9H10Cl3N and a molecular weight of 238.54 g/mol. Its IUPAC name is N-(chloromethyl)-1-(2,4-dichlorophenyl)-N-methylmethanamine.
| Compound Name | N-(chloromethyl)-1-(2,4-dichlorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115263252 |
| Molecular Formula | C9H10Cl3N |
| Molecular Weight | 238.54 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | N-(chloromethyl)-1-(2,4-dichlorophenyl)-N-methylmethanamine |
| SMILES | CN(CCl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl3N/c1-13(6-10)5-7-2-3-8(11)4-9(7)12/h2-4H,5-6H2,1H3 |
| InChIKey | SJAIYMVSGYMITP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|