C13H15Cl2N — CID 3936376
N-[(2,4-dichlorophenyl)methyl]-N-prop-2-enylprop-2-en-1-amine (PubChem CID 3936376) has the molecular formula C13H15Cl2N and a molecular weight of 256.18 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-prop-2-enylprop-2-en-1-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-prop-2-enylprop-2-en-1-amine |
|---|---|
| PubChem CID | 3936376 |
| Molecular Formula | C13H15Cl2N |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCN(CC=C)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N/c1-3-7-16(8-4-2)10-11-5-6-12(14)9-13(11)15/h3-6,9H,1-2,7-8,10H2 |
| InChIKey | TZKPCMNRBZFZEU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|